| SL Drugs and Pharmaceuticals Pvt. Ltd. | India | Inquire | ||
|---|---|---|---|---|
![]() |
+91 (40) 6661-1133 | |||
![]() |
enquiry@sldrugs.com | |||
| Chemical distributor since 1999 | ||||
| Name | 2-(Methylamino)-5-Chlorobenzophenone Imine |
|---|---|
| Synonyms | 2-(Benzenecarboximidoyl)-4-Chloro-N-Methyl-Aniline; 4-Chloro-2-(Imino-Phenylmethyl)-N-Methylaniline; [2-(Benzimidoyl)-4-Chloro-Phenyl]-Methyl-Amine |
| Molecular Structure | ![]() |
| Molecular Formula | C14H13ClN2 |
| Molecular Weight | 244.72 |
| CAS Registry Number | 5606-40-6 |
| SMILES | C1=C(C(=CC(=C1)Cl)C(C2=CC=CC=C2)=N)NC |
| InChI | 1S/C14H13ClN2/c1-17-13-8-7-11(15)9-12(13)14(16)10-5-3-2-4-6-10/h2-9,16-17H,1H3 |
| InChIKey | YIBUYDHSWMGPBG-UHFFFAOYSA-N |
| Density | 1.16g/cm3 (Cal.) |
|---|---|
| Boiling point | 396.67°C at 760 mmHg (Cal.) |
| Flash point | 193.7°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 2-(Methylamino)-5-Chlorobenzophenone Imine |