Online Database of Chemicals from Around the World
| BOC Sciences | USA | Inquire | ||
|---|---|---|---|---|
 |
+1 (631) 485-4226 | |||
 |
info@bocsci.com | |||
 |
Skype Chat | |||
| Chemical distributor | ||||
| chemBlink standard supplier since 2010 | ||||
| Name | 3,7,9-Trimethyldeca-1,6-Dien-3-Ol |
|---|---|
| Synonyms | 1,6-Decadien-3-Ol, 3,7,9-Trimethyl-; 3,7,9-Trimethyl-1,6-Decadien-3-Ol; 3,7,9-Trimethyldeca-1,6-Dien-3-Ol |
| Molecular Structure |  |
| Molecular Formula | C13H24O |
| Molecular Weight | 196.33 |
| CAS Registry Number | 56105-46-5 |
| EINECS | 259-994-1 |
| SMILES | C(C(O)(C=C)C)C/C=C(/CC(C)C)C |
| InChI | 1S/C13H24O/c1-6-13(5,14)9-7-8-12(4)10-11(2)3/h6,8,11,14H,1,7,9-10H2,2-5H3/b12-8+ |
| InChIKey | XVNDKDXSDQQJTO-XYOKQWHBSA-N |
| Density | 0.855g/cm3 (Cal.) |
|---|---|
| Boiling point | 275.928°C at 760 mmHg (Cal.) |
| Flash point | 98.162°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 3,7,9-Trimethyldeca-1,6-Dien-3-Ol |