Online Database of Chemicals from Around the World
| Alfa Chemistry | USA | Inquire | ||
|---|---|---|---|---|
 |
+1 (201) 478-8534 | |||
 |
inquiry@alfa-chemistry.com | |||
| Chemical distributor since 2012 | ||||
| chemBlink standard supplier since 2012 | ||||
| BOC Sciences | USA | Inquire | ||
|---|---|---|---|---|
|
+1 (631) 485-4226 | |||
|
info@bocsci.com | |||
 |
Skype Chat | |||
| Chemical distributor | ||||
| chemBlink standard supplier since 2010 | ||||
| Name | 4,4,8-Trimethyl-5,7-Decadien-2-One |
|---|---|
| Synonyms | 4,4,8-Trimethyl-5,7-Decadien-2-One; 5,7-Decadien-2-One, 4,4,8-Trimethyl- |
| Molecular Structure |  |
| Molecular Formula | C13H22O |
| Molecular Weight | 194.32 |
| CAS Registry Number | 67801-41-6 |
| EINECS | 267-161-9 |
| SMILES | C(C(=O)C)C(\C=C\C=C(C)\CC)(C)C |
| InChI | 1S/C13H22O/c1-6-11(2)8-7-9-13(4,5)10-12(3)14/h7-9H,6,10H2,1-5H3/b9-7+,11-8+ |
| InChIKey | VPZYONTUNFBDMF-BIZFVBGRSA-N |
| Density | 0.855g/cm3 (Cal.) |
|---|---|
| Boiling point | 273.168°C at 760 mmHg (Cal.) |
| Flash point | 98.118°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 4,4,8-Trimethyl-5,7-Decadien-2-One |