| BOC Sciences | USA | Inquire | ||
|---|---|---|---|---|
![]() |
+1 (631) 485-4226 | |||
![]() |
info@bocsci.com | |||
![]() |
Skype Chat | |||
| Chemical distributor | ||||
| chemBlink standard supplier since 2010 | ||||
| Classification | Biochemical >> Amino acids and their derivatives >> Tryptophan derivatives |
|---|---|
| Name | 4-Chlorobenzoyl-L-Tryptophan Calcium Salt |
| Synonyms | Calcium (2S)-2-[[(4-Chlorophenyl)-Oxomethyl]Amino]-3-(1H-Indol-3-Yl)Propanoate; Calcium (2S)-2-[(4-Chlorobenzoyl)Amino]-3-(1H-Indol-3-Yl)Propionate; Calcium (2S)-2-[(4-Chlorophenyl)Carbonylamino]-3-(1H-Indol-3-Yl)Propanoate |
| Molecular Structure | ![]() |
| Molecular Formula | C36H28CaCl2N4O6 |
| Molecular Weight | 723.63 |
| CAS Registry Number | 56116-62-2 |
| EINECS | 260-001-9 |
| SMILES | [C@H](NC(=O)C1=CC=C(Cl)C=C1)(CC2=C[NH]C3=CC=CC=C23)C([O-])=O.[C@H](NC(=O)C4=CC=C(Cl)C=C4)(CC5=C[NH]C6=CC=CC=C56)C([O-])=O.[Ca++] |
| InChI | 1S/2C18H15ClN2O3.Ca/c2*19-13-7-5-11(6-8-13)17(22)21-16(18(23)24)9-12-10-20-15-4-2-1-3-14(12)15;/h2*1-8,10,16,20H,9H2,(H,21,22)(H,23,24);/q;;+2/p-2/t2*16-;/m00./s1 |
| InChIKey | BTTZKEFKFLGNEC-WUBQCMAVSA-L |
| Boiling point | 643.7°C at 760 mmHg (Cal.) |
|---|---|
| Flash point | 343.1°C (Cal.) |
| SDS | Available |
|---|---|
| Market Analysis Reports |
| List of Reports Available for 4-Chlorobenzoyl-L-Tryptophan Calcium Salt |