Online Database of Chemicals from Around the World
|
CAS#: 562-17-4 Product: Bis(Diethylamino)Fluorophosphine Oxide No suppilers available for the product. |
| Name | Bis(Diethylamino)Fluorophosphine Oxide |
|---|---|
| Synonyms | N-(Diethylamino-Fluoro-Phosphoryl)-N-Ethyl-Ethanamine; (Diethylamino-Fluoro-Phosphoryl)-Diethyl-Amine; 4-04-00-00426 (Beilstein Handbook Reference) |
| Molecular Structure |  |
| Molecular Formula | C8H20FN2OP |
| Molecular Weight | 210.23 |
| CAS Registry Number | 562-17-4 |
| SMILES | C(N([P](N(CC)CC)(=O)F)CC)C |
| InChI | 1S/C8H20FN2OP/c1-5-10(6-2)13(9,12)11(7-3)8-4/h5-8H2,1-4H3 |
| InChIKey | CLBUXACREGVPRZ-UHFFFAOYSA-N |
| Density | 1.027g/cm3 (Cal.) |
|---|---|
| Boiling point | 241.814°C at 760 mmHg (Cal.) |
| Flash point | 100.046°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Bis(Diethylamino)Fluorophosphine Oxide |