Online Database of Chemicals from Around the World
| BOC Sciences | USA | Inquire | ||
|---|---|---|---|---|
 |
+1 (631) 485-4226 | |||
 |
info@bocsci.com | |||
 |
Skype Chat | |||
| Chemical distributor | ||||
| chemBlink standard supplier since 2010 | ||||
| Zylexa Pharma Ltd. | UK | Inquire | ||
|---|---|---|---|---|
|
+44 (845) 299-6009/ | |||
|
sales@zylexa-pharma.com,enquiries@zylexa-pharma.com | |||
| Chemical manufacturer | ||||
| Name | [(4-Nitrophenyl)Methyl]Succinic Acid |
|---|---|
| Synonyms | 2-(4-Nitrobenzyl)Succinic Acid; ((4-Nitrophenyl)Methyl)Succinic Acid |
| Molecular Structure | ![CAS#: 56416-12-7， [(4-Nitrophenyl)Methyl]Succinic Acid](/moreStructures/56416-12-7.gif) |
| Molecular Formula | C11H11NO6 |
| Molecular Weight | 253.21 |
| CAS Registry Number | 56416-12-7 |
| EINECS | 260-164-6 |
| SMILES | C1=C(C=CC(=C1)[N+](=O)[O-])CC(CC(=O)O)C(=O)O |
| InChI | 1S/C11H11NO6/c13-10(14)6-8(11(15)16)5-7-1-3-9(4-2-7)12(17)18/h1-4,8H,5-6H2,(H,13,14)(H,15,16) |
| InChIKey | DYDFGNHHYHDJLU-UHFFFAOYSA-N |
| Density | 1.462g/cm3 (Cal.) |
|---|---|
| Boiling point | 426.893°C at 760 mmHg (Cal.) |
| Flash point | 182.881°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for [(4-Nitrophenyl)Methyl]Succinic Acid |