Online Database of Chemicals from Around the World
|
CAS#: 73215-03-9 Product: 9-[(4-Nitrophenyl)Methyl]Purin-6-Amine No suppilers available for the product. |
| Name | 9-[(4-Nitrophenyl)Methyl]Purin-6-Amine |
|---|---|
| Synonyms | 9-[(4-Nitrophenyl)Methyl]-6-Purinamine; [9-(4-Nitrobenzyl)Purin-6-Yl]Amine; 9-(P-Nitrobenzyl)Adenine |
| Molecular Structure | ![CAS#: 73215-03-9， 9-[(4-Nitrophenyl)Methyl]Purin-6-Amine](/moreStructures/73215-03-9.gif) |
| Molecular Formula | C12H10N6O2 |
| Molecular Weight | 270.25 |
| CAS Registry Number | 73215-03-9 |
| SMILES | C2=NC(=C1N=C[N](C1=N2)CC3=CC=C(C=C3)[N+]([O-])=O)N |
| InChI | 1S/C12H10N6O2/c13-11-10-12(15-6-14-11)17(7-16-10)5-8-1-3-9(4-2-8)18(19)20/h1-4,6-7H,5H2,(H2,13,14,15) |
| InChIKey | RPALJMDJHWZXMU-UHFFFAOYSA-N |
| Density | 1.615g/cm3 (Cal.) |
|---|---|
| Boiling point | 587.138°C at 760 mmHg (Cal.) |
| Flash point | 308.89°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 9-[(4-Nitrophenyl)Methyl]Purin-6-Amine |