Online Database of Chemicals from Around the World
| BOC Sciences | USA | Inquire | ||
|---|---|---|---|---|
 |
+1 (631) 485-4226 | |||
 |
info@bocsci.com | |||
 |
Skype Chat | |||
| Chemical distributor | ||||
| chemBlink standard supplier since 2010 | ||||
| Name | 2,3-Diphenylalanine |
|---|---|
| Synonyms | (2R)-2-Amino-2,3-Di(Phenyl)Propionic Acid; 2,3-Diphenylalanine; Alanine, 2,3-Diphenyl- |
| Molecular Structure |  |
| Molecular Formula | C15H15NO2 |
| Molecular Weight | 241.29 |
| CAS Registry Number | 56594-95-7 |
| SMILES | [C@@](C(=O)O)(N)(CC1=CC=CC=C1)C2=CC=CC=C2 |
| InChI | 1S/C15H15NO2/c16-15(14(17)18,13-9-5-2-6-10-13)11-12-7-3-1-4-8-12/h1-10H,11,16H2,(H,17,18)/t15-/m1/s1 |
| InChIKey | YMCRTUKBQGPJNL-OAHLLOKOSA-N |
| Density | 1.215g/cm3 (Cal.) |
|---|---|
| Boiling point | 377.626°C at 760 mmHg (Cal.) |
| Flash point | 182.182°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 2,3-Diphenylalanine |