|
CAS#: 566-60-9 Product: 16,(5-beta)-Pregnen-3-beta-Ol-20-One No suppilers available for the product. |
| Name | 16,(5-beta)-Pregnen-3-beta-Ol-20-One |
|---|---|
| Synonyms | 16-Dehydropregnanolone; 16-Pregnenolone; 3-Alpha-Hydroxy-5-Beta-Pregn-16-En-20-One |
| Molecular Structure | ![]() |
| Molecular Formula | C21H32O2 |
| Molecular Weight | 316.48 |
| CAS Registry Number | 566-60-9 |
| SMILES | [C@H]13[C@@H]([C@@]2([C@H](CC1)C[C@H](O)CC2)C)CC[C@]4([C@H]3CC=C4C(=O)C)C |
| InChI | 1S/C21H32O2/c1-13(22)17-6-7-18-16-5-4-14-12-15(23)8-10-20(14,2)19(16)9-11-21(17,18)3/h6,14-16,18-19,23H,4-5,7-12H2,1-3H3/t14-,15-,16+,18+,19+,20+,21-/m1/s1 |
| InChIKey | SFXPZLCQRZASKK-UHGZNKHPSA-N |
| Density | 1.078g/cm3 (Cal.) |
|---|---|
| Boiling point | 443.741°C at 760 mmHg (Cal.) |
| Flash point | 189.131°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 16,(5-beta)-Pregnen-3-beta-Ol-20-One |