|
CAS#: 2204-13-9 Product: (3beta)-Pregn-1-Ene-3,17,20-Triol No suppilers available for the product. |
| Name | (3beta)-Pregn-1-Ene-3,17,20-Triol |
|---|---|
| Synonyms | pregnene-3β,17α,20α-triol |
| Molecular Structure | ![]() |
| Molecular Formula | C21H34O3 |
| Molecular Weight | 334.49 |
| CAS Registry Number | 2204-13-9 |
| SMILES | CC([C@]1(CC[C@@H]2[C@@]1(CC[C@H]3[C@H]2CCC4[C@@]3(C=C[C@@H](C4)O)C)C)O)O |
| InChI | 1S/C21H34O3/c1-13(22)21(24)11-8-18-16-5-4-14-12-15(23)6-9-19(14,2)17(16)7-10-20(18,21)3/h6,9,13-18,22-24H,4-5,7-8,10-12H2,1-3H3/t13?,14?,15-,16+,17-,18-,19-,20-,21-/m0/s1 |
| InChIKey | LYSXNEPCBZDHLZ-GUERJWNQSA-N |
| Density | 1.142g/cm3 (Cal.) |
|---|---|
| Boiling point | 472.835°C at 760 mmHg (Cal.) |
| Flash point | 210.8°C (Cal.) |
| Refractive index | 1.563 (Cal.) |
| Market Analysis Reports |
| List of Reports Available for (3beta)-Pregn-1-Ene-3,17,20-Triol |