Online Database of Chemicals from Around the World
|
CAS#: 56604-98-9 Product: (Z)-alpha,beta-Dimethyl-N-Isopropylcinnamamide No suppilers available for the product. |
| Name | (Z)-alpha,beta-Dimethyl-N-Isopropylcinnamamide |
|---|---|
| Synonyms | (Z)-N-Isopropyl-2-Methyl-3-Phenyl-But-2-Enamide; (Z)-N-Isopropyl-2-Methyl-3-Phenylbut-2-Enamide; (Z)-2-Methyl-3-Phenyl-N-Propan-2-Yl-But-2-Enamide |
| Molecular Structure |  |
| Molecular Formula | C14H19NO |
| Molecular Weight | 217.31 |
| CAS Registry Number | 56604-98-9 |
| SMILES | C1=C(C(=C(C(=O)NC(C)C)/C)/C)C=CC=C1 |
| InChI | 1S/C14H19NO/c1-10(2)15-14(16)12(4)11(3)13-8-6-5-7-9-13/h5-10H,1-4H3,(H,15,16)/b12-11- |
| InChIKey | KVLQSJWHJRGPQB-QXMHVHEDSA-N |
| Density | 0.977g/cm3 (Cal.) |
|---|---|
| Boiling point | 366.597°C at 760 mmHg (Cal.) |
| Flash point | 221.598°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for (Z)-alpha,beta-Dimethyl-N-Isopropylcinnamamide |