Online Database of Chemicals from Around the World
|
CAS#: 7358-62-5 Product: 1,3-Dimethyl-5-Isopropylbarbituric Acid No suppilers available for the product. |
| Name | 1,3-Dimethyl-5-Isopropylbarbituric Acid |
|---|---|
| Synonyms | 5-Isopropyl-1,3-Dimethyl-Hexahydropyrimidine-2,4,6-Trione; 5-Isopropyl-1,3-Dimethylhexahydropyrimidine-2,4,6-Trione; 5-Isopropyl-1,3-Dimethyl-Barbituric Acid |
| Molecular Structure |  |
| Molecular Formula | C9H14N2O3 |
| Molecular Weight | 198.22 |
| CAS Registry Number | 7358-62-5 |
| SMILES | CN1C(=O)C(C(=O)N(C1=O)C)C(C)C |
| InChI | 1S/C9H14N2O3/c1-5(2)6-7(12)10(3)9(14)11(4)8(6)13/h5-6H,1-4H3 |
| InChIKey | UDOOPVQAORZPMV-UHFFFAOYSA-N |
| Density | 1.165g/cm3 (Cal.) |
|---|---|
| Boiling point | 264.405°C at 760 mmHg (Cal.) |
| Flash point | 102.709°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 1,3-Dimethyl-5-Isopropylbarbituric Acid |