Online Database of Chemicals from Around the World
| BOC Sciences | USA | Inquire | ||
|---|---|---|---|---|
 |
+1 (631) 485-4226 | |||
 |
info@bocsci.com | |||
 |
Skype Chat | |||
| Chemical distributor | ||||
| chemBlink standard supplier since 2010 | ||||
| Name | 1,1-Dicyclopropylbenzenemethanol |
|---|---|
| Synonyms | Dicyclopropyl-Phenyl-Methanol; St5406128; Zinc02162265 |
| Molecular Structure |  |
| Molecular Formula | C13H16O |
| Molecular Weight | 188.27 |
| CAS Registry Number | 5689-19-0 |
| EINECS | 227-156-4 |
| SMILES | C3=C(C(C1CC1)(C2CC2)O)C=CC=C3 |
| InChI | 1S/C13H16O/c14-13(11-6-7-11,12-8-9-12)10-4-2-1-3-5-10/h1-5,11-12,14H,6-9H2 |
| InChIKey | FOGMKFIZSXPVNT-UHFFFAOYSA-N |
| Density | 1.209g/cm3 (Cal.) |
|---|---|
| Boiling point | 308.921°C at 760 mmHg (Cal.) |
| Flash point | 135.52°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 1,1-Dicyclopropylbenzenemethanol |