Online Database of Chemicals from Around the World
| Alfa Chemistry | USA | Inquire | ||
|---|---|---|---|---|
 |
+1 (201) 478-8534 | |||
 |
inquiry@alfa-chemistry.com | |||
| Chemical distributor since 2012 | ||||
| chemBlink standard supplier since 2012 | ||||
| BOC Sciences | USA | Inquire | ||
|---|---|---|---|---|
|
+1 (631) 485-4226 | |||
|
info@bocsci.com | |||
 |
Skype Chat | |||
| Chemical distributor | ||||
| chemBlink standard supplier since 2010 | ||||
| Name | 1,1-Dicyclopropylethylene |
|---|---|
| Synonyms | 1-Cyclopropylvinylcyclopropane; Ethylene, 1,1-Dicyclopropyl-; Inchi=1/C8h12/C1-6(7-2-3-7)8-4-5-8/H7-8H,1-5H |
| Molecular Structure |  |
| Molecular Formula | C8H12 |
| Molecular Weight | 108.18 |
| CAS Registry Number | 822-93-5 |
| EINECS | 212-508-1 |
| SMILES | C2C(C(C1CC1)=C)C2 |
| InChI | 1S/C8H12/c1-6(7-2-3-7)8-4-5-8/h7-8H,1-5H2 |
| InChIKey | RXCSODBXHNSSCQ-UHFFFAOYSA-N |
| Density | 1.001g/cm3 (Cal.) |
|---|---|
| Boiling point | 128.57°C at 760 mmHg (Cal.) |
| Flash point | 12.64°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 1,1-Dicyclopropylethylene |