Online Database of Chemicals from Around the World
| Alfa Chemistry | USA | Inquire | ||
|---|---|---|---|---|
 |
+1 (201) 478-8534 | |||
 |
inquiry@alfa-chemistry.com | |||
| Chemical distributor since 2012 | ||||
| chemBlink standard supplier since 2012 | ||||
| Name | Phenanthrene-1,4-Dione |
|---|---|
| Synonyms | Phenanthrene-1,4-Quinone; 1,4-Phenanthrenedione; Nsc148970 |
| Molecular Structure |  |
| Molecular Formula | C14H8O2 |
| Molecular Weight | 208.22 |
| CAS Registry Number | 569-15-3 |
| SMILES | C1=C3C(=C2C(=C1)C=CC=C2)C(C=CC3=O)=O |
| InChI | 1S/C14H8O2/c15-12-7-8-13(16)14-10-4-2-1-3-9(10)5-6-11(12)14/h1-8H |
| InChIKey | POZPGRADIOPGIR-UHFFFAOYSA-N |
| Density | 1.329g/cm3 (Cal.) |
|---|---|
| Boiling point | 406.027°C at 760 mmHg (Cal.) |
| Flash point | 152.022°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Phenanthrene-1,4-Dione |