Online Database of Chemicals from Around the World
|
CAS#: 14140-04-6 Product: 9,10-Phenanthrenequinone Monoxime No suppilers available for the product. |
| Name | 9,10-Phenanthrenequinone Monoxime |
|---|---|
| Synonyms | 10-Nitroso-9-Phenanthrenol; 9,10-Pqm; Oprea1_219959 |
| Molecular Structure |  |
| Molecular Formula | C14H9NO2 |
| Molecular Weight | 223.23 |
| CAS Registry Number | 14140-04-6 |
| SMILES | C1=CC=CC2=C1C3=C(C(=C2N=O)O)C=CC=C3 |
| InChI | 1S/C14H9NO2/c16-14-12-8-4-2-6-10(12)9-5-1-3-7-11(9)13(14)15-17/h1-8,16H |
| InChIKey | HMJPSXRANHDJOF-UHFFFAOYSA-N |
| Density | 1.3g/cm3 (Cal.) |
|---|---|
| Boiling point | 458.529°C at 760 mmHg (Cal.) |
| Flash point | 231.111°C (Cal.) |
| SDS | Available |
|---|---|
| Market Analysis Reports |
| List of Reports Available for 9,10-Phenanthrenequinone Monoxime |