Online Database of Chemicals from Around the World
| Alfa Chemistry | USA | Inquire | ||
|---|---|---|---|---|
 |
+1 (201) 478-8534 | |||
 |
inquiry@alfa-chemistry.com | |||
| Chemical distributor since 2012 | ||||
| chemBlink standard supplier since 2012 | ||||
| Name | 1-(1-Phenylethyl)-4-[1-(3,4-Xylyl)Ethyl]Benzene |
|---|---|
| Synonyms | 1-(1-Phenylethyl)-4-(1-(3,4-Xylyl)Ethyl)Benzene |
| Molecular Structure | ![CAS#: 56922-56-6， 1-(1-Phenylethyl)-4-[1-(3,4-Xylyl)Ethyl]Benzene](/moreStructures/56922-56-6.gif) |
| Molecular Formula | C24H26 |
| Molecular Weight | 314.47 |
| CAS Registry Number | 56922-56-6 |
| EINECS | 260-435-9 |
| SMILES | C1=C(C(=CC=C1C(C3=CC=C(C(C2=CC=CC=C2)C)C=C3)C)C)C |
| InChI | 1S/C24H26/c1-17-10-11-24(16-18(17)2)20(4)23-14-12-22(13-15-23)19(3)21-8-6-5-7-9-21/h5-16,19-20H,1-4H3 |
| InChIKey | NTASRDMNIODWLU-UHFFFAOYSA-N |
| Density | 0.997g/cm3 (Cal.) |
|---|---|
| Boiling point | 431.914°C at 760 mmHg (Cal.) |
| Flash point | 213.239°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 1-(1-Phenylethyl)-4-[1-(3,4-Xylyl)Ethyl]Benzene |