Online Database of Chemicals from Around the World
|
CAS#: 71965-07-6 Product: 2-Phenylethyl Trichloroacetate No suppilers available for the product. |
| Name | 2-Phenylethyl Trichloroacetate |
|---|---|
| Synonyms | 2,2,2-Trichloroacetic Acid 2-Phenylethyl Ester; 2-Phenylethyl 2,2,2-Trichloroethanoate; Trichloroacetic Acid, 2-Phenylethyl Ester |
| Molecular Structure |  |
| Molecular Formula | C10H9Cl3O2 |
| Molecular Weight | 267.54 |
| CAS Registry Number | 71965-07-6 |
| EINECS | 276-227-6 |
| SMILES | C1=C(CCOC(C(Cl)(Cl)Cl)=O)C=CC=C1 |
| InChI | 1S/C10H9Cl3O2/c11-10(12,13)9(14)15-7-6-8-4-2-1-3-5-8/h1-5H,6-7H2 |
| InChIKey | ZIOAZUXFQCBCKA-UHFFFAOYSA-N |
| Density | 1.387g/cm3 (Cal.) |
|---|---|
| Boiling point | 312.052°C at 760 mmHg (Cal.) |
| Flash point | 123.384°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 2-Phenylethyl Trichloroacetate |