Online Database of Chemicals from Around the World
|
CAS#: 56961-21-8 Product: 4,5,6-Trichlorobenzene-1,2,3-Triol No suppilers available for the product. |
| Name | 4,5,6-Trichlorobenzene-1,2,3-Triol |
|---|---|
| Synonyms | 4,5,6-Trichloropyrogallol; 1,2,3-Benzenetriol, 4,5,6-Trichloro-; 4-06-00-07334 (Beilstein Handbook Reference) |
| Molecular Structure |  |
| Molecular Formula | C6H3Cl3O3 |
| Molecular Weight | 229.45 |
| CAS Registry Number | 56961-21-8 |
| SMILES | C1(=C(C(=C(C(=C1O)O)Cl)Cl)Cl)O |
| InChI | 1S/C6H3Cl3O3/c7-1-2(8)4(10)6(12)5(11)3(1)9/h10-12H |
| InChIKey | CJQALGPVJPPULG-UHFFFAOYSA-N |
| Density | 1.903g/cm3 (Cal.) |
|---|---|
| Boiling point | 340.029°C at 760 mmHg (Cal.) |
| Flash point | 159.444°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 4,5,6-Trichlorobenzene-1,2,3-Triol |