Online Database of Chemicals from Around the World
|
CAS#: 63390-12-5 Product: 3,3',5-Trichlorobenzidine No suppilers available for the product. |
| Name | 3,3',5-Trichlorobenzidine |
|---|---|
| Synonyms | 4-(4-Amino-3-Chloro-Phenyl)-2,6-Dichloro-Aniline; [4-(4-Amino-3-Chloro-Phenyl)-2,6-Dichloro-Phenyl]Amine; (1,1'-Biphenyl)-4,4'-Diamine, 3,3',5-Trichloro- (9Ci) |
| Molecular Structure |  |
| Molecular Formula | C12H9Cl3N2 |
| Molecular Weight | 287.58 |
| CAS Registry Number | 63390-12-5 |
| SMILES | C2=C(C1=CC(=C(N)C=C1)Cl)C=C(Cl)C(=C2Cl)N |
| InChI | 1S/C12H9Cl3N2/c13-8-3-6(1-2-11(8)16)7-4-9(14)12(17)10(15)5-7/h1-5H,16-17H2 |
| InChIKey | FOHQHSMQKDVWSW-UHFFFAOYSA-N |
| Density | 1.474g/cm3 (Cal.) |
|---|---|
| Boiling point | 397.128°C at 760 mmHg (Cal.) |
| Flash point | 193.976°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 3,3',5-Trichlorobenzidine |