Online Database of Chemicals from Around the World
| Interbioscreen Ltd. | Russian Federation | Inquire | ||
|---|---|---|---|---|
 |
+7 (49) 6524-0091 | |||
 |
screen@ibscreen.chg.ru | |||
| Chemical manufacturer | ||||
| Name | 17-alpha-Hydroxyepipregnanolone |
|---|---|
| Synonyms | Stock1n-56888; 17-Alpha-Hydroxypregnanolone; 3-Alpha,17-Alpha-Dihydroxy-5-Beta-Pregnan-20-One |
| Molecular Structure |  |
| Molecular Formula | C21H34O3 |
| Molecular Weight | 334.50 |
| CAS Registry Number | 570-52-5 |
| SMILES | [C@@]14(C)[C@H]([C@H]2[C@H](CC1)[C@]3(C)[C@H](CC2)C[C@@H](CC3)O)CC[C@@]4(C(C)=O)O |
| InChI | 1S/C21H34O3/c1-13(22)21(24)11-8-18-16-5-4-14-12-15(23)6-9-19(14,2)17(16)7-10-20(18,21)3/h14-18,23-24H,4-12H2,1-3H3/t14-,15-,16-,17+,18+,19+,20+,21+/m1/s1 |
| InChIKey | LKQDFQLSEHWIRK-UKBVDAKRSA-N |
| Density | 1.123g/cm3 (Cal.) |
|---|---|
| Boiling point | 465.446°C at 760 mmHg (Cal.) |
| Flash point | 249.411°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 17-alpha-Hydroxyepipregnanolone |