Online Database of Chemicals from Around the World
|
CAS#: 67484-39-3 Product: 7-Hydroxyellipticine No suppilers available for the product. |
| Name | 7-Hydroxyellipticine |
|---|---|
| Synonyms | 6H-Pyrido(4,3-B)Carbazol-7-Ol, 5,11-Dimethyl-; 7-Hydroxyellipticine |
| Molecular Structure |  |
| Molecular Formula | C17H14N2O |
| Molecular Weight | 262.31 |
| CAS Registry Number | 67484-39-3 |
| SMILES | C2=CC1=C(C)C3=C(C(=C1C=N2)C)C4=C([NH]3)C(=CC=C4)O |
| InChI | 1S/C17H14N2O/c1-9-13-8-18-7-6-11(13)10(2)16-15(9)12-4-3-5-14(20)17(12)19-16/h3-8,19-20H,1-2H3 |
| InChIKey | LMKVVMVYEHURBO-UHFFFAOYSA-N |
| Density | 1.35g/cm3 (Cal.) |
|---|---|
| Boiling point | 557.749°C at 760 mmHg (Cal.) |
| Flash point | 291.116°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 7-Hydroxyellipticine |