Online Database of Chemicals from Around the World
|
CAS#: 57321-63-8 Product: Trichlorodiphenyl ether No suppilers available for the product. |
| Name | Trichlorodiphenyl ether |
|---|---|
| Synonyms | Ai3-00034; Benzene, 1,1'-Oxybis-, Trichloro Derivative; Trichlorophenyl Ether |
| Molecular Structure |  |
| Molecular Formula | C12H7Cl3O |
| Molecular Weight | 273.55 |
| CAS Registry Number | 57321-63-8 (59039-21-3) |
| SMILES | C2=C(OC1=CC=C(Cl)C=C1)C(=CC(=C2)Cl)Cl |
| InChI | 1S/C12H7Cl3O/c13-8-1-4-10(5-2-8)16-12-6-3-9(14)7-11(12)15/h1-7H |
| InChIKey | PIORTDHJOLELKR-UHFFFAOYSA-N |
| Density | 1.397g/cm3 (Cal.) |
|---|---|
| Boiling point | 326.485°C at 760 mmHg (Cal.) |
| Flash point | 120.13°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Trichlorodiphenyl ether |