| BOC Sciences | USA | Inquire | ||
|---|---|---|---|---|
![]() |
+1 (631) 485-4226 | |||
![]() |
info@bocsci.com | |||
![]() |
Skype Chat | |||
| Chemical distributor | ||||
| chemBlink standard supplier since 2010 | ||||
| SelectLab Chemicals GmbH | Germany | Inquire | ||
|---|---|---|---|---|
![]() |
+49 (2383) 919-350 / 919-351 | |||
![]() |
info@selectlab.de, | |||
| Chemical manufacturer | ||||
| SynQuest Labs, Inc. | USA | Inquire | ||
|---|---|---|---|---|
![]() |
+1 (386) 462-0788 | |||
![]() |
info@synquestlabs.com | |||
| Chemical manufacturer | ||||
| Name | 1,3,5-Trichloro-2,4-Dinitrobenzene |
|---|---|
| Synonyms | 1,3,5-Trichloro-2,4-Dinitro-Benzene; Benzene, 2,4-Dinitro-1,3,5-Trichloro-; Nsc5279 |
| Molecular Structure | ![]() |
| Molecular Formula | C6HCl3N2O4 |
| Molecular Weight | 271.44 |
| CAS Registry Number | 6284-83-9 |
| EINECS | 228-510-0 |
| SMILES | C1=C(C(=C(C(=C1Cl)[N+](=O)[O-])Cl)[N+](=O)[O-])Cl |
| InChI | 1S/C6HCl3N2O4/c7-2-1-3(8)6(11(14)15)4(9)5(2)10(12)13/h1H |
| InChIKey | BPMOJGOPWSCNHJ-UHFFFAOYSA-N |
| Density | 1.822g/cm3 (Cal.) |
|---|---|
| Boiling point | 366.806°C at 760 mmHg (Cal.) |
| Flash point | 175.638°C (Cal.) |
| (1) | P. E. Kruger, P. R. Mackie and M. Nieuwenhuyzen. Redetermination of 1,3,5-trichloro-2,4-dinitrobenzene, Acta Cryst. (2000). C56, e532 |
|---|---|
| Market Analysis Reports |
| List of Reports Available for 1,3,5-Trichloro-2,4-Dinitrobenzene |