Online Database of Chemicals from Around the World
|
CAS#: 57803-44-8 Product: 4-(2,6-Dichloroisonicotinoyl)Morpholine No suppilers available for the product. |
| Name | 4-(2,6-Dichloroisonicotinoyl)Morpholine |
|---|---|
| Synonyms | (2,6-Dichloro-4-Pyridyl)-Morpholino-Methanone; (2,6-Dichloro-4-Pyridyl)-Morpholinomethanone; (2,6-Dichloropyridin-4-Yl)-Morpholin-4-Yl-Methanone |
| Molecular Structure |  |
| Molecular Formula | C10H10Cl2N2O2 |
| Molecular Weight | 261.11 |
| CAS Registry Number | 57803-44-8 |
| SMILES | C2=C(C(N1CCOCC1)=O)C=C(N=C2Cl)Cl |
| InChI | 1S/C10H10Cl2N2O2/c11-8-5-7(6-9(12)13-8)10(15)14-1-3-16-4-2-14/h5-6H,1-4H2 |
| InChIKey | AIIGKPCMCFGSPV-UHFFFAOYSA-N |
| Density | 1.429g/cm3 (Cal.) |
|---|---|
| Boiling point | 457.364°C at 760 mmHg (Cal.) |
| Flash point | 230.405°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 4-(2,6-Dichloroisonicotinoyl)Morpholine |