Online Database of Chemicals from Around the World
| Otava Ltd. | Ukraine | Inquire | ||
|---|---|---|---|---|
 |
+380 (44) 522-2458 | |||
 |
order@otavachemicals.com | |||
| Chemical manufacturer since 1997 | ||||
| Name | 4,5-Dichloroisophthalic Acid |
|---|---|
| Molecular Structure |  |
| Molecular Formula | C8H4Cl2O4 |
| Molecular Weight | 235.02 |
| CAS Registry Number | 6660-66-8 |
| SMILES | Clc1c(cc(cc1Cl)C(O)=O)C(O)=O |
| InChI | 1S/C8H4Cl2O4/c9-5-2-3(7(11)12)1-4(6(5)10)8(13)14/h1-2H,(H,11,12)(H,13,14) |
| InChIKey | VFQOQIZHPUADMI-UHFFFAOYSA-N |
| Density | 1.698g/cm3 (Cal.) |
|---|---|
| Boiling point | 439.908°C at 760 mmHg (Cal.) |
| Flash point | 219.848°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 4,5-Dichloroisophthalic Acid |