Online Database of Chemicals from Around the World
|
CAS#: 5794-14-9 Product: Aspidospermatine No suppilers available for the product. |
| Name | Aspidospermatine |
|---|---|
| Synonyms | Aspidospermatine |
| Molecular Structure |  |
| Molecular Formula | C21H26N2O2 |
| Molecular Weight | 338.45 |
| CAS Registry Number | 5794-14-9 |
| SMILES | [C@]135[C@H](N(C(=O)C)C2=C(OC)C=CC=C12)C[C@@H]4C(\[C@H]3N(CC4)CC5)=C/C |
| InChI | 1S/C21H26N2O2/c1-4-15-14-8-10-22-11-9-21(20(15)22)16-6-5-7-17(25-3)19(16)23(13(2)24)18(21)12-14/h4-7,14,18,20H,8-12H2,1-3H3/b15-4+/t14-,18-,20-,21-/m1/s1 |
| InChIKey | CCNTUVFHVFQEJI-ULBRXFQASA-N |
| Density | 1.25g/cm3 (Cal.) |
|---|---|
| Boiling point | 539.517°C at 760 mmHg (Cal.) |
| Flash point | 280.09°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Aspidospermatine |