| BOC Sciences | USA | Inquire | ||
|---|---|---|---|---|
![]() |
+1 (631) 485-4226 | |||
![]() |
info@bocsci.com | |||
![]() |
Skype Chat | |||
| Chemical distributor | ||||
| chemBlink standard supplier since 2010 | ||||
| Name | Aspirin, Phenacetin, And Caffeine |
|---|---|
| Synonyms | 2-Acetoxybenzoic Acid; N-(4-Ethoxyphenyl)Acetamide; 1,3,7-Trimethylpurine-2,6-Dione; 2-Acetoxybenzoic Acid; N-P-Phenetylacetamide; 1,3,7-Trimethylxanthine |
| Molecular Structure | ![]() |
| Molecular Formula | C27H31N5O8 |
| Molecular Weight | 553.57 |
| CAS Registry Number | 8003-03-0 |
| SMILES | C1=CC(=CC=C1OCC)NC(C)=O.C2=CC=CC(=C2OC(C)=O)C(O)=O.C4=NC3=C(C(N(C(N3C)=O)C)=O)[N]4C |
| InChI | 1S/C10H13NO2.C9H8O4.C8H10N4O2/c1-3-13-10-6-4-9(5-7-10)11-8(2)12;1-6(10)13-8-5-3-2-4-7(8)9(11)12;1-10-4-9-6-5(10)7(13)12(3)8(14)11(6)2/h4-7H,3H2,1-2H3,(H,11,12);2-5H,1H3,(H,11,12);4H,1-3H3 |
| InChIKey | PITMOJXAHYPVLG-UHFFFAOYSA-N |
| Boiling point | 416.8°C at 760 mmHg (Cal.) |
|---|---|
| Flash point | 205.9°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Aspirin, Phenacetin, And Caffeine |