Online Database of Chemicals from Around the World
|
CAS#: 58109-33-4 Product: Fluoromethyl 2-Methoxy-2,2-Difluoro-1-(Trifluoromethyl)Ethyl Ether No suppilers available for the product. |
| Name | Fluoromethyl 2-Methoxy-2,2-Difluoro-1-(Trifluoromethyl)Ethyl Ether |
|---|---|
| Synonyms | 1,1,1,3,3-Pentafluoro-2-(Fluoromethoxy)-3-Methoxy-Propane; 2-(Fluoromethoxy)-3-Methoxy-1,1,1,3,3-Pentafluoropropane; Fluoromethyl 2-Methoxy-2,2-Difluoro-1-(Trifluoromethyl)Ethyl Ether |
| Molecular Structure |  |
| Molecular Formula | C5H6F6O2 |
| Molecular Weight | 212.09 |
| CAS Registry Number | 58109-33-4 |
| SMILES | C(F)OC(C(F)(F)OC)C(F)(F)F |
| InChI | 1S/C5H6F6O2/c1-12-5(10,11)3(13-2-6)4(7,8)9/h3H,2H2,1H3 |
| InChIKey | GIRCVFXPLMQPGW-UHFFFAOYSA-N |
| Density | 1.351g/cm3 (Cal.) |
|---|---|
| Boiling point | 103.037°C at 760 mmHg (Cal.) |
| Flash point | 21.551°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Fluoromethyl 2-Methoxy-2,2-Difluoro-1-(Trifluoromethyl)Ethyl Ether |