| Pure Research Chemicals | China | Inquire | ||
|---|---|---|---|---|
![]() | www.purerechem.com | |||
![]() | +86 (551) 6288-8437 +86 18096409024 | |||
![]() | info@purerechem.com | |||
![]() | QQ Chat | |||
![]() | Skype Chat | |||
![]() | WeChat: 18856022585 | |||
| Chemical manufacturer since 2018 | ||||
| Name | Diclofenac Impurity 14 |
|---|---|
| Synonyms | 2,4-dichloro-N-phenylaniline |
| Molecular Structure | ![]() |
| Molecular Formula | C12H9Cl2N |
| Molecular Weight | 238.11 |
| CAS Registry Number | 58373-59-4 |
| SMILES | C1=CC=C(C=C1)NC2=C(C=C(C=C2)Cl)Cl |
| Solubility | 3.371 mg/L (25 °C water) |
|---|---|
| Density | 1.3±0.0 g/cm3, Calc.* |
| Index of Refraction | 1.649, Calc.* |
| Melting point | 99.66 °C |
| Boiling Point | 328.90 °C, 328.2±0.0 °C (760 mmHg), Calc.* |
| Flash Point | 152.3±0.0 °C, Calc.* |
| * | Calculated using Advanced Chemistry Development (ACD/Labs) Software. |
| Market Analysis Reports |
| List of Reports Available for Diclofenac Impurity 14 |