|
CAS#: 5856-10-0 Product: Androstane-3,17-Diol No suppilers available for the product. |
| Name | Androstane-3,17-Diol |
|---|---|
| Synonyms | Androstanediol; CHEBI:27727 |
| Molecular Structure | ![]() |
| Molecular Formula | C19H32O2 |
| Molecular Weight | 292.46 |
| CAS Registry Number | 5856-10-0 |
| SMILES | OC4CC3[C@]([C@@H]1[C@H]([C@H]2[C@](C)(CC1)C(O)CC2)CC3)(C)CC4 |
| InChI | 1S/C19H32O2/c1-18-9-7-13(20)11-12(18)3-4-14-15-5-6-17(21)19(15,2)10-8-16(14)18/h12-17,20-21H,3-11H2,1-2H3/t12?,13?,14-,15-,16-,17?,18-,19-/m0/s1 |
| InChIKey | CBMYJHIOYJEBSB-CAHXEBCQSA-N |
| Density | 1.091g/cm3 (Cal.) |
|---|---|
| Boiling point | 414.973°C at 760 mmHg (Cal.) |
| Flash point | 186.039°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Androstane-3,17-Diol |