Online Database of Chemicals from Around the World
|
CAS#: 5856-11-1 Product: (3beta,5beta,17alpha)-Androstane-3,17-Diol No suppilers available for the product. |
| Name | (3beta,5beta,17alpha)-Androstane-3,17-Diol |
|---|---|
| Molecular Structure |  |
| Molecular Formula | C19H32O2 |
| Molecular Weight | 292.46 |
| CAS Registry Number | 5856-11-1 |
| SMILES | O[C@@H]4CC[C@H]3[C@H]2[C@@H]([C@@]1([C@@H](C[C@@H](O)CC1)CC2)C)CC[C@@]34C |
| InChI | 1S/C19H32O2/c1-18-9-7-13(20)11-12(18)3-4-14-15-5-6-17(21)19(15,2)10-8-16(14)18/h12-17,20-21H,3-11H2,1-2H3/t12-,13+,14+,15+,16+,17-,18+,19+/m1/s1 |
| InChIKey | CBMYJHIOYJEBSB-YISWTCPOSA-N |
| Density | 1.091g/cm3 (Cal.) |
|---|---|
| Boiling point | 414.973°C at 760 mmHg (Cal.) |
| Flash point | 186.039°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for (3beta,5beta,17alpha)-Androstane-3,17-Diol |