Online Database of Chemicals from Around the World
|
CAS#: 58683-70-8 Product: 2,4,5-Tribromocumene No suppilers available for the product. |
| Name | 2,4,5-Tribromocumene |
|---|---|
| Synonyms | 1,2,4-Tribromo-5-Isopropyl-Benzene; 1,2,4-Tribromo-5-Isopropylbenzene; 1,2,4-Tribromo-5-Propan-2-Yl-Benzene |
| Molecular Structure |  |
| Molecular Formula | C9H9Br3 |
| Molecular Weight | 356.88 |
| CAS Registry Number | 58683-70-8 |
| EINECS | 261-388-7 |
| SMILES | C1=C(C(=CC(=C1Br)Br)Br)C(C)C |
| InChI | 1S/C9H9Br3/c1-5(2)6-3-8(11)9(12)4-7(6)10/h3-5H,1-2H3 |
| InChIKey | PVLAYJSXFLUWPB-UHFFFAOYSA-N |
| Density | 1.898g/cm3 (Cal.) |
|---|---|
| Boiling point | 329.253°C at 760 mmHg (Cal.) |
| Flash point | 149.497°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 2,4,5-Tribromocumene |