Online Database of Chemicals from Around the World
| BOC Sciences | USA | Inquire | ||
|---|---|---|---|---|
 |
+1 (631) 485-4226 | |||
 |
info@bocsci.com | |||
 |
Skype Chat | |||
| Chemical distributor | ||||
| chemBlink standard supplier since 2010 | ||||
| Name | 1,3,8-Tribromodibenzo-p-Dioxin |
|---|---|
| Synonyms | 1,3,8-Tribromodibenzo-P-Dioxin; 1,3,8-Tribromo-Dibenzo-Dioxin |
| Molecular Structure |  |
| Molecular Formula | C12H5Br3O2 |
| Molecular Weight | 420.88 |
| CAS Registry Number | 80246-33-9 |
| SMILES | C1=C(C=C2C(=C1)OC3=C(O2)C(=CC(=C3)Br)Br)Br |
| InChI | 1S/C12H5Br3O2/c13-6-1-2-9-10(4-6)17-12-8(15)3-7(14)5-11(12)16-9/h1-5H |
| InChIKey | NLKFBKPFQWQPPL-UHFFFAOYSA-N |
| Density | 2.14g/cm3 (Cal.) |
|---|---|
| Boiling point | 419.07°C at 760 mmHg (Cal.) |
| Flash point | 173.333°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 1,3,8-Tribromodibenzo-p-Dioxin |