|
CAS#: 58781-88-7 Product: Tetrabromo-p-Biphenyldiol No suppilers available for the product. |
| Name | Tetrabromo-p-Biphenyldiol |
|---|---|
| Synonyms | Tetrabrom-P-Biphenol; Tetrabromo-P-Biphenol; Tetrabromo-P-Diphenol |
| Molecular Structure | ![]() |
| Molecular Formula | C12H6Br4O2 |
| Molecular Weight | 501.79 |
| CAS Registry Number | 58781-88-7 |
| SMILES | C2=C(C1=C(Br)C(=C(O)C(=C1Br)Br)Br)C=CC(=C2)O |
| InChI | 1S/C12H6Br4O2/c13-8-7(5-1-3-6(17)4-2-5)9(14)11(16)12(18)10(8)15/h1-4,17-18H |
| InChIKey | VCPOGIZHOKSLGN-UHFFFAOYSA-N |
| Density | 2.32g/cm3 (Cal.) |
|---|---|
| Boiling point | 405.259°C at 760 mmHg (Cal.) |
| Flash point | 198.894°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Tetrabromo-p-Biphenyldiol |