Online Database of Chemicals from Around the World
| Atomax Chemicals Co., Ltd. | China | Inquire | ||
|---|---|---|---|---|
 |
+86 13417589054/ | |||
 |
info@atomaxchem.com,atomax.chemicals@gmail.com | |||
 |
QQ Chat | |||
| Chemical manufacturer | ||||
| Name | 5,7-Difluoro-2-(2-Pyridinyl)Indoline |
|---|---|
| Synonyms | 5,7-difluoro-2-(pyridin-2-yl)indoline |
| Molecular Structure |  |
| Molecular Formula | C13H10F2N2 |
| Molecular Weight | 232.23 |
| CAS Registry Number | 591721-07-2 |
| SMILES | Fc1cc3c(c(F)c1)NC(c2ncccc2)C3 |
| InChI | 1S/C13H10F2N2/c14-9-5-8-6-12(11-3-1-2-4-16-11)17-13(8)10(15)7-9/h1-5,7,12,17H,6H2 |
| InChIKey | FALYMZOMGOYYFX-UHFFFAOYSA-N |
| Density | 1.287g/cm3 (Cal.) |
|---|---|
| Boiling point | 336.632°C at 760 mmHg (Cal.) |
| Flash point | 157.39°C (Cal.) |
| Refractive index | 1.576 (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 5,7-Difluoro-2-(2-Pyridinyl)Indoline |