Online Database of Chemicals from Around the World
| BOC Sciences | USA | Inquire | ||
|---|---|---|---|---|
 |
+1 (631) 485-4226 | |||
 |
info@bocsci.com | |||
 |
Skype Chat | |||
| Chemical distributor | ||||
| chemBlink standard supplier since 2010 | ||||
| Name | Ammonium Phenolate |
|---|---|
| Synonyms | Ammonium Phenolate; Phenol Ammonium Salt |
| Molecular Structure |  |
| Molecular Formula | C6H9NO |
| Molecular Weight | 111.14 |
| CAS Registry Number | 5973-17-1 |
| EINECS | 227-769-7 |
| SMILES | [CH-]1C(=O)C=CC=C1.[NH4+] |
| InChI | 1S/C6H5O.H3N/c7-6-4-2-1-3-5-6;/h1-5H;1H3/q-1;/p+1 |
| InChIKey | ASULOOCHANTDQI-UHFFFAOYSA-O |
| Market Analysis Reports |
| List of Reports Available for Ammonium Phenolate |