Online Database of Chemicals from Around the World
|
CAS#: 6130-43-4 Product: Ammonium Perfluoroheptanoate No suppilers available for the product. |
| Name | Ammonium Perfluoroheptanoate |
|---|---|
| Synonyms | Ammonia; 2,2,3,3,4,4,5,5,6,6,7,7,7-Tridecafluoroheptanoic Acid; Ammonia; 2,2,3,3,4,4,5,5,6,6,7,7,7-Tridecafluoroenanthic Acid |
| Molecular Structure |  |
| Molecular Formula | C7H4F13NO2 |
| Molecular Weight | 381.09 |
| CAS Registry Number | 6130-43-4 |
| EINECS | 228-098-2 |
| SMILES | O=C(O)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F.N |
| InChI | 1S/C7HF13O2.H3N/c8-2(9,1(21)22)3(10,11)4(12,13)5(14,15)6(16,17)7(18,19)20;/h(H,21,22);1H3 |
| InChIKey | JVZREVRTMWNFME-UHFFFAOYSA-N |
| Boiling point | 175.8°C at 760 mmHg (Cal.) |
|---|---|
| Flash point | 51.3°C (Cal.) |
| SDS | Available |
|---|---|
| Market Analysis Reports |
| List of Reports Available for Ammonium Perfluoroheptanoate |