Online Database of Chemicals from Around the World
| Alfa Chemistry | USA | Inquire | ||
|---|---|---|---|---|
 |
+1 (201) 478-8534 | |||
 |
inquiry@alfa-chemistry.com | |||
| Chemical distributor since 2012 | ||||
| chemBlink standard supplier since 2012 | ||||
| BOC Sciences | USA | Inquire | ||
|---|---|---|---|---|
|
+1 (631) 485-4226 | |||
|
info@bocsci.com | |||
 |
Skype Chat | |||
| Chemical distributor | ||||
| chemBlink standard supplier since 2010 | ||||
| Name | 1-(2,4,6-Tribromophenyl)-1H-Pyrrole-2,5-Dione |
|---|---|
| Synonyms | 1-(2,4,6-Tribromophenyl)-3-Pyrroline-2,5-Quinone; 1H-Pyrrole-2,5-Dione, 1-(2,4,6-Tribromophenyl)-; N-(2,4,6-Tribromophenyl)Maleimide |
| Molecular Structure |  |
| Molecular Formula | C10H4Br3NO2 |
| Molecular Weight | 409.86 |
| CAS Registry Number | 59789-51-4 |
| SMILES | C1=C(C=C(Br)C(=C1Br)N2C(=O)C=CC2=O)Br |
| InChI | 1S/C10H4Br3NO2/c11-5-3-6(12)10(7(13)4-5)14-8(15)1-2-9(14)16/h1-4H |
| InChIKey | ONEIBTGSNPDDSB-UHFFFAOYSA-N |
| Density | 2.292g/cm3 (Cal.) |
|---|---|
| Boiling point | 442.562°C at 760 mmHg (Cal.) |
| Flash point | 221.454°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 1-(2,4,6-Tribromophenyl)-1H-Pyrrole-2,5-Dione |