Online Database of Chemicals from Around the World
|
CAS#: 76461-14-8 Product: (2,4,6-Tribromophenyl) Propanoate No suppilers available for the product. |
| Name | (2,4,6-Tribromophenyl) Propanoate |
|---|---|
| Synonyms | Propanoic Acid (2,4,6-Tribromophenyl) Ester; Propionic Acid (2,4,6-Tribromophenyl) Ester; 2,4,6-Tribromophenyl Propionate |
| Molecular Structure |  |
| Molecular Formula | C9H7Br3O2 |
| Molecular Weight | 386.87 |
| CAS Registry Number | 76461-14-8 |
| EINECS | 278-470-3 |
| SMILES | C1=C(Br)C=C(Br)C(=C1Br)OC(=O)CC |
| InChI | 1S/C9H7Br3O2/c1-2-8(13)14-9-6(11)3-5(10)4-7(9)12/h3-4H,2H2,1H3 |
| InChIKey | AYPLUWLTDGVVIR-UHFFFAOYSA-N |
| Density | 2.014g/cm3 (Cal.) |
|---|---|
| Boiling point | 361.101°C at 760 mmHg (Cal.) |
| Flash point | 172.188°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for (2,4,6-Tribromophenyl) Propanoate |