Online Database of Chemicals from Around the World
| Alfa Chemistry | USA | Inquire | ||
|---|---|---|---|---|
 |
+1 (201) 478-8534 | |||
 |
inquiry@alfa-chemistry.com | |||
| Chemical distributor since 2012 | ||||
| chemBlink standard supplier since 2012 | ||||
| Name | 1,1,1,3,9,11,11,11-Octachloroundecane |
|---|---|
| Synonyms | 1,1,1,3,9,11,11,11-Octachloroundecane; 1,1,1,3,9,11,11,11-Octachloroundécane; 1,1,1,3,9,11,11,11-Octachlorundecan |
| Molecular Structure |  |
| Molecular Formula | C11H16Cl8 |
| Molecular Weight | 431.87 |
| CAS Registry Number | 601523-25-5 |
| SMILES | C(CCC(CC(Cl)(Cl)Cl)Cl)CCC(CC(Cl)(Cl)Cl)Cl |
| InChI | 1S/C11H16Cl8/c12-8(6-10(14,15)16)4-2-1-3-5-9(13)7-11(17,18)19/h8-9H,1-7H2 |
| InChIKey | GYNMKPTWBKSWPK-UHFFFAOYSA-N |
| Density | 1.4±0.1g/cm3 (Cal.) |
|---|---|
| Boiling point | 412.0±13.0°C at 760 mmHg (Cal.) |
| Flash point | 190.6±17.2°C (Cal.) |
| Refractive index | 1.519 (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 1,1,1,3,9,11,11,11-Octachloroundecane |