| Shanghai Qyubiotech Co., Ltd. | China | Inquire | ||
|---|---|---|---|---|
![]() | www.qyubiotech.com | |||
![]() | +86 (021) 3759-6619 | |||
![]() | +86 (021) 3759-6619 | |||
![]() | lioner@qyubiotech.com | |||
![]() | QQ Chat | |||
| Chemical distributor since 2015 | ||||
| chemBlink Standard supplier since 2022 | ||||
| Name | 4-(1-Adamantyl)pyridine |
|---|---|
| Molecular Structure | ![]() |
| Molecular Formula | C15H19N |
| Molecular Weight | 213.32 |
| CAS Registry Number | 60159-38-8 |
| SMILES | C1C2CC3CC1CC(C2)(C3)C4=CC=NC=C4 |
| Solubility | 6.287 mg/L (25 °C water) |
|---|---|
| Density | 1.1±0.1 g/cm3, Calc.* |
| Index of Refraction | 1.590, Calc.* |
| Melting point | 84.61 °C |
| Boiling Point | 300.19 °C, 329.4±11.0 °C (760 mmHg), Calc.* |
| Flash Point | 191.9±12.0 °C, Calc.* |
| * | Calculated using Advanced Chemistry Development (ACD/Labs) Software. |
| Hazard Symbols | |
|---|---|
| Risk Statements | H302 Details |
| Safety Statements | P280-P305+P351+P338 Details |
| SDS | Available |
| Market Analysis Reports |
| List of Reports Available for 4-(1-Adamantyl)pyridine |