Online Database of Chemicals from Around the World
|
CAS#: 6037-91-8 Product: Trifluoro(1,1,2,2-Tetrafluoro-2-Iodoethoxy)Ethylene No suppilers available for the product. |
| Name | Trifluoro(1,1,2,2-Tetrafluoro-2-Iodoethoxy)Ethylene |
|---|---|
| Synonyms | 1,1,2-Trifluoro-2-(1,1,2,2-Tetrafluoro-2-Iodo-Ethoxy)Ethylene; 1,1,2-Trifluoro-2-(1,1,2,2-Tetrafluoro-2-Iodoethoxy)Ethylene; 1,1,2-Trifluoro-2-(1,1,2,2-Tetrafluoro-2-Iodo-Ethoxy)Ethene |
| Molecular Structure |  |
| Molecular Formula | C4F7IO |
| Molecular Weight | 323.94 |
| CAS Registry Number | 6037-91-8 |
| EINECS | 227-922-8 |
| SMILES | C(OC(C(I)(F)F)(F)F)(=C(F)F)F |
| InChI | 1S/C4F7IO/c5-1(6)2(7)13-4(10,11)3(8,9)12 |
| InChIKey | OURRZLCUWZZPKV-UHFFFAOYSA-N |
| Density | 2.142g/cm3 (Cal.) |
|---|---|
| Boiling point | 105.765°C at 760 mmHg (Cal.) |
| Flash point | 17.766°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Trifluoro(1,1,2,2-Tetrafluoro-2-Iodoethoxy)Ethylene |