Online Database of Chemicals from Around the World
|
CAS#: 69661-30-9 Product: 2,3,5-Trifluorotetrahydro-4-(Pentafluoroethyl)-2,3,4,5-Tetrakis(Trifluoromethyl)Furan No suppilers available for the product. |
| Name | 2,3,5-Trifluorotetrahydro-4-(Pentafluoroethyl)-2,3,4,5-Tetrakis(Trifluoromethyl)Furan |
|---|---|
| Synonyms | 2,3,5-Trifluoro-4-(1,1,2,2,2-Pentafluoroethyl)-2,3,4,5-Tetrakis(Trifluoromethyl)Tetrahydrofuran; 2,3,5-Trifluorotetrahydro-4-(Pentafluoroethyl)-2,3,4,5-Tetrakis(Trifluoromethyl)Furan |
| Molecular Structure |  |
| Molecular Formula | C10F20O |
| Molecular Weight | 516.08 |
| CAS Registry Number | 69661-30-9 |
| EINECS | 274-065-0 |
| SMILES | O1C(F)(C(C(F)(C1(F)C(F)(F)F)C(F)(F)F)(C(F)(F)C(F)(F)F)C(F)(F)F)C(F)(F)F |
| InChI | 1S/C10F20O/c11-2(7(19,20)21)1(6(16,17)18,3(12,13)8(22,23)24)4(14,9(25,26)27)31-5(2,15)10(28,29)30 |
| InChIKey | ROKBKBIVJKPRAG-UHFFFAOYSA-N |
| Density | 1.801g/cm3 (Cal.) |
|---|---|
| Boiling point | 145.564°C at 760 mmHg (Cal.) |
| Flash point | 47.749°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 2,3,5-Trifluorotetrahydro-4-(Pentafluoroethyl)-2,3,4,5-Tetrakis(Trifluoromethyl)Furan |