Online Database of Chemicals from Around the World
| BOC Sciences | USA | Inquire | ||
|---|---|---|---|---|
 |
+1 (631) 485-4226 | |||
 |
info@bocsci.com | |||
 |
Skype Chat | |||
| Chemical distributor | ||||
| chemBlink standard supplier since 2010 | ||||
| Name | 2,6-Dichlorodibenzofuran |
|---|---|
| Synonyms | Dibenzofuran, 2,6-Dichloro; Dibenzofuran, 2,6-Dichloro- |
| Molecular Structure |  |
| Molecular Formula | C12H6Cl2O |
| Molecular Weight | 237.08 |
| CAS Registry Number | 60390-27-4 |
| SMILES | C1=C2C(=C(C=C1)Cl)OC3=C2C=C(C=C3)Cl |
| InChI | 1S/C12H6Cl2O/c13-7-4-5-11-9(6-7)8-2-1-3-10(14)12(8)15-11/h1-6H |
| InChIKey | XVLCNKFGFHUQNL-UHFFFAOYSA-N |
| Density | 1.442g/cm3 (Cal.) |
|---|---|
| Boiling point | 356.401°C at 760 mmHg (Cal.) |
| Flash point | 169.345°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 2,6-Dichlorodibenzofuran |