Online Database of Chemicals from Around the World
|
CAS#: 845-30-7 Product: 3,3'-Dichlorodibenzoyl Peroxide No suppilers available for the product. |
| Name | 3,3'-Dichlorodibenzoyl Peroxide |
|---|---|
| Synonyms | 3-Chlorobenzenecarboperoxoic Acid [(3-Chlorophenyl)-Oxomethyl] Ester; 3-Chlorobenzenecarboperoxoic Acid (3-Chlorobenzoyl) Ester; (3-Chlorophenyl)Carbonyl 3-Chlorobenzenecarboperoxoate |
| Molecular Structure |  |
| Molecular Formula | C14H8Cl2O4 |
| Molecular Weight | 311.12 |
| CAS Registry Number | 845-30-7 |
| SMILES | C1=CC=C(C=C1Cl)C(=O)OOC(=O)C2=CC(=CC=C2)Cl |
| InChI | 1S/C14H8Cl2O4/c15-11-5-1-3-9(7-11)13(17)19-20-14(18)10-4-2-6-12(16)8-10/h1-8H |
| InChIKey | XBDOGXHLESIJJK-UHFFFAOYSA-N |
| Density | 1.434g/cm3 (Cal.) |
|---|---|
| Boiling point | 430.247°C at 760 mmHg (Cal.) |
| Flash point | 175.533°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 3,3'-Dichlorodibenzoyl Peroxide |