Online Database of Chemicals from Around the World
| BOC Sciences | USA | Inquire | ||
|---|---|---|---|---|
 |
+1 (631) 485-4226 | |||
 |
info@bocsci.com | |||
 |
Skype Chat | |||
| Chemical distributor | ||||
| chemBlink standard supplier since 2010 | ||||
| Name | 2,6-Dichloroanthracene-9-10-Dione |
|---|---|
| Synonyms | 2,6-Dichloro-9,10-Anthraquinone; 2,6-Dichloroanthraquinone; 9,10-Anthracenedione, 2,6-Dichloro- |
| Molecular Structure |  |
| Molecular Formula | C14H6Cl2O2 |
| Molecular Weight | 277.11 |
| CAS Registry Number | 605-40-3 |
| SMILES | C1=C(Cl)C=CC2=C1C(=O)C3=C(C2=O)C=C(Cl)C=C3 |
| InChI | 1S/C14H6Cl2O2/c15-7-1-3-9-11(5-7)14(18)10-4-2-8(16)6-12(10)13(9)17/h1-6H |
| InChIKey | KJGPMAHVCDFRBN-UHFFFAOYSA-N |
| Density | 1.514g/cm3 (Cal.) |
|---|---|
| Boiling point | 455.177°C at 760 mmHg (Cal.) |
| Flash point | 191.651°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 2,6-Dichloroanthracene-9-10-Dione |