Online Database of Chemicals from Around the World
| Name | 1,3-Dichloroanthraquinone |
|---|---|
| Synonyms | 1,3-Dichloro-9,10-Anthraquinone; 9,10-Anthracenedione, 1,3-Dichloro-; Anthraquinone, 1,3-Dichloro- |
| Molecular Structure |  |
| Molecular Formula | C14H6Cl2O2 |
| Molecular Weight | 277.11 |
| CAS Registry Number | 602-73-3 |
| SMILES | C3=C(Cl)C1=C(C(C2=C(C1=O)C=CC=C2)=O)C=C3Cl |
| InChI | 1S/C14H6Cl2O2/c15-7-5-10-12(11(16)6-7)14(18)9-4-2-1-3-8(9)13(10)17/h1-6H |
| InChIKey | ZQNAPBOSLCTZIB-UHFFFAOYSA-N |
| Density | 1.514g/cm3 (Cal.) |
|---|---|
| Boiling point | 455.177°C at 760 mmHg (Cal.) |
| Flash point | 191.651°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 1,3-Dichloroanthraquinone |
