Online Database of Chemicals from Around the World
| Achemica | Switzerland | Inquire | ||
|---|---|---|---|---|
 |
+41 (24) 466-2929 | |||
 |
contact@achemica.com | |||
| Chemical manufacturer since 2010 | ||||
| Alfa Chemistry | USA | Inquire | ||
|---|---|---|---|---|
|
+1 (201) 478-8534 | |||
|
inquiry@alfa-chemistry.com | |||
| Chemical distributor since 2012 | ||||
| chemBlink standard supplier since 2012 | ||||
| Name | 2,4'-Dinitrobiphenyl |
|---|---|
| Synonyms | 1,1'-Biphenyl, 2,4'-Dinitro- (9Ci); 2,4'-Dinitro-1,1'-Biphenyl; 2,4'-Dinitrobiphenyl |
| Molecular Structure |  |
| Molecular Formula | C12H8N2O4 |
| Molecular Weight | 244.21 |
| CAS Registry Number | 606-81-5 |
| EINECS | 210-124-9 |
| SMILES | C1=CC=CC(=C1C2=CC=C(C=C2)[N+](=O)[O-])[N+](=O)[O-] |
| InChI | 1S/C12H8N2O4/c15-13(16)10-7-5-9(6-8-10)11-3-1-2-4-12(11)14(17)18/h1-8H |
| InChIKey | IZNVUHOCXBQQHM-UHFFFAOYSA-N |
| Density | 1.369g/cm3 (Cal.) |
|---|---|
| Boiling point | 402.637°C at 760 mmHg (Cal.) |
| Flash point | 198.289°C (Cal.) |
| SDS | Available |
|---|---|
| Market Analysis Reports |
| List of Reports Available for 2,4'-Dinitrobiphenyl |