Online Database of Chemicals from Around the World
|
CAS#: 6311-43-9 Product: 3,4'-Dinitrobiphenyl No suppilers available for the product. |
| Name | 3,4'-Dinitrobiphenyl |
|---|---|
| Synonyms | 1,1'-Biphenyl, 3,4'-Dinitro- (9Ci); 3,4'-Dinitro-1,1'-Biphenyl; Brn 1982974 |
| Molecular Structure |  |
| Molecular Formula | C12H8N2O4 |
| Molecular Weight | 244.21 |
| CAS Registry Number | 6311-43-9 |
| SMILES | C2=C(C1=CC=C(C=C1)[N+](=O)[O-])C=CC=C2[N+](=O)[O-] |
| InChI | 1S/C12H8N2O4/c15-13(16)11-6-4-9(5-7-11)10-2-1-3-12(8-10)14(17)18/h1-8H |
| InChIKey | LTPDHLOPQDBSOL-UHFFFAOYSA-N |
| Density | 1.369g/cm3 (Cal.) |
|---|---|
| Boiling point | 417.031°C at 760 mmHg (Cal.) |
| Flash point | 208.114°C (Cal.) |
| SDS | Available |
|---|---|
| Market Analysis Reports |
| List of Reports Available for 3,4'-Dinitrobiphenyl |